C60H109NO2 — CID 71294611
2-[4,5-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-6-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-2-yl]-N,N-dimethylethanamine (PubChem CID 71294611) has the molecular formula C60H109NO2 and a molecular weight of 876.54 g/mol. Its IUPAC name is 2-[4,5-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-6-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4,5-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-6-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 71294611 |
| Molecular Formula | C60H109NO2 |
| Molecular Weight | 876.54 g/mol |
| Exact Mass | 875.85 |
| IUPAC Name | 2-[4,5-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-6-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-2-yl]-N,N-dimethylethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1OC(CCN(C)C)OC(CCCCCCC/C=C\C/C=C\CCCCC)C1CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C60H109NO2/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-54-59-57(52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2)58(62-60(63-59)55-56-61(4)5)53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3/h18-23,27-32,57-60H,6-17,24-26,33-56H2,1-5H3/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29- |
| InChIKey | ISVWLCPCBPEMHM-CWJLHRMTSA-N |
| XLogP | 19.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.54 |
| LogP ≤ 5 | 19.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|