About 2-bromo-6,7-dihydro-4H-1,4-benzoxazine
2-bromo-6,7-dihydro-4H-1,4-benzoxazine (PubChem CID 71295273) has the molecular formula C8H8BrNO
and a molecular weight of 214.06 g/mol. Its IUPAC name is 2-bromo-6,7-dihydro-4H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 2-bromo-6,7-dihydro-4H-1,4-benzoxazine |
| PubChem CID | 71295273 |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | 2-bromo-6,7-dihydro-4H-1,4-benzoxazine |
| SMILES | BrC1=CNC2=CCCC=C2O1 |
| InChI | InChI=1S/C8H8BrNO/c9-8-5-10-6-3-1-2-4-7(6)11-8/h3-5,10H,1-2H2 |
| InChIKey | ZGNFPTXYOHQXKV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-6,7-dihydro-4H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6,7-dihydro-4H-1,4-benzoxazine?
The IUPAC name of 2-bromo-6,7-dihydro-4H-1,4-benzoxazine (CID 71295273) is 2-bromo-6,7-dihydro-4H-1,4-benzoxazine.
What is the SMILES notation for 2-bromo-6,7-dihydro-4H-1,4-benzoxazine?
The canonical SMILES for 2-bromo-6,7-dihydro-4H-1,4-benzoxazine is BrC1=CNC2=CCCC=C2O1.
What is the InChIKey of 2-bromo-6,7-dihydro-4H-1,4-benzoxazine?
The InChIKey is ZGNFPTXYOHQXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO/c9-8-5-10-6-3-1-2-4-7(6)11-8/h3-5,10H,1-2H2.
What are the key properties of 2-bromo-6,7-dihydro-4H-1,4-benzoxazine?
2-bromo-6,7-dihydro-4H-1,4-benzoxazine has a molecular weight of 214.06 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6,7-dihydro-4H-1,4-benzoxazine is sourced from PubChem (CID 71295273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).