About 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one
5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one (PubChem CID 71295596) has the molecular formula C12H8BrN3O
and a molecular weight of 290.12 g/mol. Its IUPAC name is 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one |
| PubChem CID | 71295596 |
| Molecular Formula | C12H8BrN3O |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(Br)cc1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C12H8BrN3O/c13-8-5-9(12(17)14-6-8)10-7-16-4-2-1-3-11(16)15-10/h1-7H,(H,14,17) |
| InChIKey | NMNNRBHQHJCVID-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one?
The IUPAC name of 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one (CID 71295596) is 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one.
What is the SMILES notation for 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one?
The canonical SMILES for 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one is O=c1[nH]cc(Br)cc1-c1cn2ccccc2n1.
What is the InChIKey of 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one?
The InChIKey is NMNNRBHQHJCVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrN3O/c13-8-5-9(12(17)14-6-8)10-7-16-4-2-1-3-11(16)15-10/h1-7H,(H,14,17).
What are the key properties of 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one?
5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one has a molecular weight of 290.12 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-imidazo[1,2-a]pyridin-2-yl-1H-pyridin-2-one is sourced from PubChem (CID 71295596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).