About 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium
3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium (PubChem CID 71295756) has the molecular formula C18H18ClN2O+
and a molecular weight of 313.81 g/mol. Its IUPAC name is 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium |
| PubChem CID | 71295756 |
| Molecular Formula | C18H18ClN2O+ |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium |
| SMILES | Cc1cc(Oc2cccc(C[n+]3cc[nH]c3)c2)cc(C)c1Cl |
| InChI | InChI=1S/C18H17ClN2O/c1-13-8-17(9-14(2)18(13)19)22-16-5-3-4-15(10-16)11-21-7-6-20-12-21/h3-10,12H,11H2,1-2H3/p+1 |
| InChIKey | KRDUMXYLMIWMMP-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 28.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium?
The IUPAC name of 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium (CID 71295756) is 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium.
What is the SMILES notation for 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium?
The canonical SMILES for 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium is Cc1cc(Oc2cccc(C[n+]3cc[nH]c3)c2)cc(C)c1Cl.
What is the InChIKey of 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium?
The InChIKey is KRDUMXYLMIWMMP-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H17ClN2O/c1-13-8-17(9-14(2)18(13)19)22-16-5-3-4-15(10-16)11-21-7-6-20-12-21/h3-10,12H,11H2,1-2H3/p+1.
What are the key properties of 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium?
3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium has a molecular weight of 313.81 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-1H-imidazol-3-ium is sourced from PubChem (CID 71295756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).