C21H38O4 — CID 71295770
7-[(1R,4S,5S,6R)-5-[(3S)-3-hydroxyoctyl]-2-oxabicyclo[2.2.1]heptan-6-yl]heptanoic acid (PubChem CID 71295770) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is 7-[(1R,4S,5S,6R)-5-[(3S)-3-hydroxyoctyl]-2-oxabicyclo[2.2.1]heptan-6-yl]heptanoic acid.
| Compound Name | 7-[(1R,4S,5S,6R)-5-[(3S)-3-hydroxyoctyl]-2-oxabicyclo[2.2.1]heptan-6-yl]heptanoic acid |
|---|---|
| PubChem CID | 71295770 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 7-[(1R,4S,5S,6R)-5-[(3S)-3-hydroxyoctyl]-2-oxabicyclo[2.2.1]heptan-6-yl]heptanoic acid |
| SMILES | CCCCC[C@H](O)CC[C@H]1[C@H]2CO[C@H](C2)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H38O4/c1-2-3-6-9-17(22)12-13-18-16-14-20(25-15-16)19(18)10-7-4-5-8-11-21(23)24/h16-20,22H,2-15H2,1H3,(H,23,24)/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | CLYISXHRQDTJTI-LCWAXJCOSA-N |
| XLogP | 4.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|