C22H31N3O3 — CID 71295838
(1S,9R,10R,11R)-5-(cyclohexen-1-yl)-N,12-diethyl-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide (PubChem CID 71295838) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is (1S,9R,10R,11R)-5-(cyclohexen-1-yl)-N,12-diethyl-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide.
| Compound Name | (1S,9R,10R,11R)-5-(cyclohexen-1-yl)-N,12-diethyl-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 71295838 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (1S,9R,10R,11R)-5-(cyclohexen-1-yl)-N,12-diethyl-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
| SMILES | CCNC(=O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(ccc(C4=CCCCC4)c3=O)[C@H]1N2CC |
| InChI | InChI=1S/C22H31N3O3/c1-3-23-21(27)19-16(13-26)18-12-25-17(20(19)24(18)4-2)11-10-15(22(25)28)14-8-6-5-7-9-14/h8,10-11,16,18-20,26H,3-7,9,12-13H2,1-2H3,(H,23,27)/t16-,18-,19+,20+/m0/s1 |
| InChIKey | YHJLTUAYXIDZER-IJXRJRJASA-N |
| XLogP | 1.93 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |