C19H27BN2O2 — CID 71295945
2-piperidin-1-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (PubChem CID 71295945) has the molecular formula C19H27BN2O2 and a molecular weight of 326.25 g/mol. Its IUPAC name is 2-piperidin-1-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile.
| Compound Name | 2-piperidin-1-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 71295945 |
| Molecular Formula | C19H27BN2O2 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-piperidin-1-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| SMILES | CC1(C)OB(c2ccc(C(C#N)N3CCCCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H27BN2O2/c1-18(2)19(3,4)24-20(23-18)16-10-8-15(9-11-16)17(14-21)22-12-6-5-7-13-22/h8-11,17H,5-7,12-13H2,1-4H3 |
| InChIKey | DWBAMUNCVWLBSN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|