C16H17NO4 — CID 712960
N-(2,5-dimethoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 712960) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 712960 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)C=Cc2ccc(C)o2)c1 |
| InChI | InChI=1S/C16H17NO4/c1-11-4-5-12(21-11)7-9-16(18)17-14-10-13(19-2)6-8-15(14)20-3/h4-10H,1-3H3,(H,17,18) |
| InChIKey | CLIVDTURURSKGN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|