About 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline
4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline (PubChem CID 71296020) has the molecular formula C18H16F2N4
and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline.
Molecular Properties
| Compound Name | 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline |
| PubChem CID | 71296020 |
| Molecular Formula | C18H16F2N4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline |
| SMILES | FC1(F)CCN(c2nc(-c3ccncc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C18H16F2N4/c19-18(20)7-11-24(12-8-18)17-14-3-1-2-4-15(14)22-16(23-17)13-5-9-21-10-6-13/h1-6,9-10H,7-8,11-12H2 |
| InChIKey | BQEFBPKSONSGIL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline?
The IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline (CID 71296020) is 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline.
What is the SMILES notation for 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline?
The canonical SMILES for 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline is FC1(F)CCN(c2nc(-c3ccncc3)nc3ccccc23)CC1.
What is the InChIKey of 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline?
The InChIKey is BQEFBPKSONSGIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N4/c19-18(20)7-11-24(12-8-18)17-14-3-1-2-4-15(14)22-16(23-17)13-5-9-21-10-6-13/h1-6,9-10H,7-8,11-12H2.
What are the key properties of 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline?
4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline has a molecular weight of 326.35 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluoropiperidin-1-yl)-2-pyridin-4-ylquinazoline is sourced from PubChem (CID 71296020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).