C28H46Cl2N8O3 — CID 71296029
(2S)-6-amino-N-[(2S)-6-amino-1-[[4-(diaminomethylideneamino)cyclohexyl]methylamino]-1-oxohexan-2-yl]-2-[[2-(3,4-dichlorophenyl)acetyl]amino]hexanamide (PubChem CID 71296029) has the molecular formula C28H46Cl2N8O3 and a molecular weight of 613.64 g/mol. Its IUPAC name is (2S)-6-amino-N-[(2S)-6-amino-1-[[4-(diaminomethylideneamino)cyclohexyl]methylamino]-1-oxohexan-2-yl]-2-[[2-(3,4-dichlorophenyl)acetyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[(2S)-6-amino-1-[[4-(diaminomethylideneamino)cyclohexyl]methylamino]-1-oxohexan-2-yl]-2-[[2-(3,4-dichlorophenyl)acetyl]amino]hexanamide |
|---|---|
| PubChem CID | 71296029 |
| Molecular Formula | C28H46Cl2N8O3 |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | (2S)-6-amino-N-[(2S)-6-amino-1-[[4-(diaminomethylideneamino)cyclohexyl]methylamino]-1-oxohexan-2-yl]-2-[[2-(3,4-dichlorophenyl)acetyl]amino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)Cc1ccc(Cl)c(Cl)c1)C(=O)N[C@@H](CCCCN)C(=O)NCC1CCC(N=C(N)N)CC1 |
| InChI | InChI=1S/C28H46Cl2N8O3/c29-21-12-9-19(15-22(21)30)16-25(39)37-24(6-2-4-14-32)27(41)38-23(5-1-3-13-31)26(40)35-17-18-7-10-20(11-8-18)36-28(33)34/h9,12,15,18,20,23-24H,1-8,10-11,13-14,16-17,31-32H2,(H,35,40)(H,37,39)(H,38,41)(H4,33,34,36)/t18?,20?,23-,24-/m0/s1 |
| InChIKey | OWKCLMWSCHVRNJ-LEDPEUEOSA-N |
| XLogP | 1.71 |
| TPSA | 203.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|