C8H9O7-3 — CID 71296187
(1R,2S)-1-hydroxypentane-1,2,5-tricarboxylate (PubChem CID 71296187) has the molecular formula C8H9O7-3 and a molecular weight of 217.15 g/mol. Its IUPAC name is (1R,2S)-1-hydroxypentane-1,2,5-tricarboxylate.
| Compound Name | (1R,2S)-1-hydroxypentane-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 71296187 |
| Molecular Formula | C8H9O7-3 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (1R,2S)-1-hydroxypentane-1,2,5-tricarboxylate |
| SMILES | O=C([O-])CCC[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C8H12O7/c9-5(10)3-1-2-4(7(12)13)6(11)8(14)15/h4,6,11H,1-3H2,(H,9,10)(H,12,13)(H,14,15)/p-3/t4-,6+/m0/s1 |
| InChIKey | KVEBLTAWTCBJNF-UJURSFKZSA-K |
| XLogP | -4.62 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |