About [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate
[4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate (PubChem CID 71296518) has the molecular formula C21H15N3O5S
and a molecular weight of 421.43 g/mol. Its IUPAC name is [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate.
Molecular Properties
| Compound Name | [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate |
| PubChem CID | 71296518 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate |
| SMILES | O=C(NNC1=NS(=O)(=O)c2ccccc21)c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15N3O5S/c25-20(23-22-19-17-8-4-5-9-18(17)30(27,28)24-19)14-10-12-16(13-11-14)29-21(26)15-6-2-1-3-7-15/h1-13H,(H,22,24)(H,23,25) |
| InChIKey | NIRGRWYGKPXGHP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate?
The IUPAC name of [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate (CID 71296518) is [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate.
What is the SMILES notation for [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate?
The canonical SMILES for [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate is O=C(NNC1=NS(=O)(=O)c2ccccc21)c1ccc(OC(=O)c2ccccc2)cc1.
What is the InChIKey of [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate?
The InChIKey is NIRGRWYGKPXGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O5S/c25-20(23-22-19-17-8-4-5-9-18(17)30(27,28)24-19)14-10-12-16(13-11-14)29-21(26)15-6-2-1-3-7-15/h1-13H,(H,22,24)(H,23,25).
What are the key properties of [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate?
[4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate has a molecular weight of 421.43 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]carbamoyl]phenyl] benzoate is sourced from PubChem (CID 71296518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).