C18H14F6N3O2+ — CID 7129716
(2-benzamido-1,1,1,3,3,3-hexafluoropropan-2-yl)-[(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium (PubChem CID 7129716) has the molecular formula C18H14F6N3O2+ and a molecular weight of 418.32 g/mol. Its IUPAC name is (2-benzamido-1,1,1,3,3,3-hexafluoropropan-2-yl)-[(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium.
| Compound Name | (2-benzamido-1,1,1,3,3,3-hexafluoropropan-2-yl)-[(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium |
|---|---|
| PubChem CID | 7129716 |
| Molecular Formula | C18H14F6N3O2+ |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (2-benzamido-1,1,1,3,3,3-hexafluoropropan-2-yl)-[(3R)-2-oxo-1,3-dihydroindol-3-yl]azanium |
| SMILES | O=C(NC([NH2+][C@H]1C(=O)Nc2ccccc21)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H13F6N3O2/c19-17(20,21)16(18(22,23)24,27-14(28)10-6-2-1-3-7-10)26-13-11-8-4-5-9-12(11)25-15(13)29/h1-9,13,26H,(H,25,29)(H,27,28)/p+1/t13-/m1/s1 |
| InChIKey | DTNMOHIEYDQLHT-CYBMUJFWSA-O |
| XLogP | 2.49 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|