About N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide
N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 71297184) has the molecular formula C13H10N2O3S3
and a molecular weight of 338.44 g/mol. Its IUPAC name is N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide |
| PubChem CID | 71297184 |
| Molecular Formula | C13H10N2O3S3 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=c1[nH]c(-c2cccc(NS(=O)(=O)c3cccs3)c2)cs1 |
| InChI | InChI=1S/C13H10N2O3S3/c16-13-14-11(8-20-13)9-3-1-4-10(7-9)15-21(17,18)12-5-2-6-19-12/h1-8,15H,(H,14,16) |
| InChIKey | PSOFLBHWUXTHTE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide?
The IUPAC name of N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide (CID 71297184) is N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide.
What is the SMILES notation for N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide?
The canonical SMILES for N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide is O=c1[nH]c(-c2cccc(NS(=O)(=O)c3cccs3)c2)cs1.
What is the InChIKey of N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide?
The InChIKey is PSOFLBHWUXTHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3S3/c16-13-14-11(8-20-13)9-3-1-4-10(7-9)15-21(17,18)12-5-2-6-19-12/h1-8,15H,(H,14,16).
What are the key properties of N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide?
N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide has a molecular weight of 338.44 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide is sourced from PubChem (CID 71297184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).