C10H14N2O4 — CID 71298527
1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine;oxalic acid (PubChem CID 71298527) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine;oxalic acid.
| Compound Name | 1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine;oxalic acid |
|---|---|
| PubChem CID | 71298527 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine;oxalic acid |
| SMILES | CC1NCCn2cccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H12N2.C2H2O4/c1-7-8-3-2-5-10(8)6-4-9-7;3-1(4)2(5)6/h2-3,5,7,9H,4,6H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HGTXMSQOKIYGFG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|