C9H16ClN3 — CID 71298900
1-methyl-2-(pyrrolidin-2-ylmethyl)imidazole;hydrochloride (PubChem CID 71298900) has the molecular formula C9H16ClN3 and a molecular weight of 201.70 g/mol. Its IUPAC name is 1-methyl-2-(pyrrolidin-2-ylmethyl)imidazole;hydrochloride.
| Compound Name | 1-methyl-2-(pyrrolidin-2-ylmethyl)imidazole;hydrochloride |
|---|---|
| PubChem CID | 71298900 |
| Molecular Formula | C9H16ClN3 |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-methyl-2-(pyrrolidin-2-ylmethyl)imidazole;hydrochloride |
| SMILES | Cl.Cn1ccnc1CC1CCCN1 |
| InChI | InChI=1S/C9H15N3.ClH/c1-12-6-5-11-9(12)7-8-3-2-4-10-8;/h5-6,8,10H,2-4,7H2,1H3;1H |
| InChIKey | URAVXOFUEDJNTG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |