C13H20ClN3O — CID 71298917
2-(3-pyridin-3-ylpropyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 71298917) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is 2-(3-pyridin-3-ylpropyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 2-(3-pyridin-3-ylpropyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 71298917 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(3-pyridin-3-ylpropyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1(CCCc2cccnc2)CCCN1 |
| InChI | InChI=1S/C13H19N3O.ClH/c14-12(17)13(7-3-9-16-13)6-1-4-11-5-2-8-15-10-11;/h2,5,8,10,16H,1,3-4,6-7,9H2,(H2,14,17);1H |
| InChIKey | XGJBVCNKLUGUEX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |