About 2,3,6-trimethoxypyridine
2,3,6-trimethoxypyridine (PubChem CID 71299130) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2,3,6-trimethoxypyridine.
Molecular Properties
| Compound Name | 2,3,6-trimethoxypyridine |
| PubChem CID | 71299130 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2,3,6-trimethoxypyridine |
| SMILES | COc1ccc(OC)c(OC)n1 |
| InChI | InChI=1S/C8H11NO3/c1-10-6-4-5-7(11-2)9-8(6)12-3/h4-5H,1-3H3 |
| InChIKey | FIDKPTFJOFOUTP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3,6-trimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethoxypyridine?
The IUPAC name of 2,3,6-trimethoxypyridine (CID 71299130) is 2,3,6-trimethoxypyridine.
What is the SMILES notation for 2,3,6-trimethoxypyridine?
The canonical SMILES for 2,3,6-trimethoxypyridine is COc1ccc(OC)c(OC)n1.
What is the InChIKey of 2,3,6-trimethoxypyridine?
The InChIKey is FIDKPTFJOFOUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-10-6-4-5-7(11-2)9-8(6)12-3/h4-5H,1-3H3.
What are the key properties of 2,3,6-trimethoxypyridine?
2,3,6-trimethoxypyridine has a molecular weight of 169.18 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethoxypyridine is sourced from PubChem (CID 71299130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).