About 3-(3,4-difluorophenoxy)azetidine;hydrochloride
3-(3,4-difluorophenoxy)azetidine;hydrochloride (PubChem CID 71299291) has the molecular formula C9H10ClF2NO
and a molecular weight of 221.63 g/mol. Its IUPAC name is 3-(3,4-difluorophenoxy)azetidine;hydrochloride.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenoxy)azetidine;hydrochloride |
| PubChem CID | 71299291 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-(3,4-difluorophenoxy)azetidine;hydrochloride |
| SMILES | Cl.Fc1ccc(OC2CNC2)cc1F |
| InChI | InChI=1S/C9H9F2NO.ClH/c10-8-2-1-6(3-9(8)11)13-7-4-12-5-7;/h1-3,7,12H,4-5H2;1H |
| InChIKey | LGYZUROTBPYFOS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-difluorophenoxy)azetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenoxy)azetidine;hydrochloride?
The IUPAC name of 3-(3,4-difluorophenoxy)azetidine;hydrochloride (CID 71299291) is 3-(3,4-difluorophenoxy)azetidine;hydrochloride.
What is the SMILES notation for 3-(3,4-difluorophenoxy)azetidine;hydrochloride?
The canonical SMILES for 3-(3,4-difluorophenoxy)azetidine;hydrochloride is Cl.Fc1ccc(OC2CNC2)cc1F.
What is the InChIKey of 3-(3,4-difluorophenoxy)azetidine;hydrochloride?
The InChIKey is LGYZUROTBPYFOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO.ClH/c10-8-2-1-6(3-9(8)11)13-7-4-12-5-7;/h1-3,7,12H,4-5H2;1H.
What are the key properties of 3-(3,4-difluorophenoxy)azetidine;hydrochloride?
3-(3,4-difluorophenoxy)azetidine;hydrochloride has a molecular weight of 221.63 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenoxy)azetidine;hydrochloride is sourced from PubChem (CID 71299291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).