About 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine
1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine (PubChem CID 71299325) has the molecular formula C24H27N3O3
and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine.
Molecular Properties
| Compound Name | 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine |
| PubChem CID | 71299325 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine |
| SMILES | COc1cc(-c2cncc(-c3ccc(N4CCNCC4)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H27N3O3/c1-28-22-13-18(14-23(29-2)24(22)30-3)20-12-19(15-26-16-20)17-4-6-21(7-5-17)27-10-8-25-9-11-27/h4-7,12-16,25H,8-11H2,1-3H3 |
| InChIKey | WFZZPLAPENBNIY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine?
The IUPAC name of 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine (CID 71299325) is 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine.
What is the SMILES notation for 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine?
The canonical SMILES for 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine is COc1cc(-c2cncc(-c3ccc(N4CCNCC4)cc3)c2)cc(OC)c1OC.
What is the InChIKey of 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine?
The InChIKey is WFZZPLAPENBNIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O3/c1-28-22-13-18(14-23(29-2)24(22)30-3)20-12-19(15-26-16-20)17-4-6-21(7-5-17)27-10-8-25-9-11-27/h4-7,12-16,25H,8-11H2,1-3H3.
What are the key properties of 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine?
1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine has a molecular weight of 405.50 g/mol, XLogP of 3.85, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine is sourced from PubChem (CID 71299325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).