C12H9F4N3O2S2 — CID 71299336
4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 71299336) has the molecular formula C12H9F4N3O2S2 and a molecular weight of 367.35 g/mol. Its IUPAC name is 4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 71299336 |
| Molecular Formula | C12H9F4N3O2S2 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | Cc1cc(C)nc(Sc2c(F)c(F)c(S(N)(=O)=O)c(F)c2F)n1 |
| InChI | InChI=1S/C12H9F4N3O2S2/c1-4-3-5(2)19-12(18-4)22-10-6(13)8(15)11(23(17,20)21)9(16)7(10)14/h3H,1-2H3,(H2,17,20,21) |
| InChIKey | PKQIZTGHFBCYEN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|