C21H18Cl2N2O3 — CID 71299352
5-amino-3-[2-(2,4-dichlorophenyl)ethyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299352) has the molecular formula C21H18Cl2N2O3 and a molecular weight of 417.29 g/mol. Its IUPAC name is 5-amino-3-[2-(2,4-dichlorophenyl)ethyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-3-[2-(2,4-dichlorophenyl)ethyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299352 |
| Molecular Formula | C21H18Cl2N2O3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 5-amino-3-[2-(2,4-dichlorophenyl)ethyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | Cc1ccc2c(c1)OC(N)=C1C(=O)N(CCc3ccc(Cl)cc3Cl)C(=O)CC12 |
| InChI | InChI=1S/C21H18Cl2N2O3/c1-11-2-5-14-15-10-18(26)25(7-6-12-3-4-13(22)9-16(12)23)21(27)19(15)20(24)28-17(14)8-11/h2-5,8-9,15H,6-7,10,24H2,1H3 |
| InChIKey | ZRXGKXODZYOTMC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|