C24H20N2O3 — CID 71299354
5-amino-8-methyl-3-(naphthalen-1-ylmethyl)-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299354) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-amino-8-methyl-3-(naphthalen-1-ylmethyl)-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-8-methyl-3-(naphthalen-1-ylmethyl)-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299354 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-amino-8-methyl-3-(naphthalen-1-ylmethyl)-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | Cc1ccc2c(c1)OC(N)=C1C(=O)N(Cc3cccc4ccccc34)C(=O)CC12 |
| InChI | InChI=1S/C24H20N2O3/c1-14-9-10-18-19-12-21(27)26(24(28)22(19)23(25)29-20(18)11-14)13-16-7-4-6-15-5-2-3-8-17(15)16/h2-11,19H,12-13,25H2,1H3 |
| InChIKey | SGCWJPTVTAETDP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|