C18H23N3O3 — CID 71299357
5-amino-3-[3-(dimethylamino)propyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299357) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 5-amino-3-[3-(dimethylamino)propyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-3-[3-(dimethylamino)propyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299357 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 5-amino-3-[3-(dimethylamino)propyl]-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | Cc1ccc2c(c1)OC(N)=C1C(=O)N(CCCN(C)C)C(=O)CC12 |
| InChI | InChI=1S/C18H23N3O3/c1-11-5-6-12-13-10-15(22)21(8-4-7-20(2)3)18(23)16(13)17(19)24-14(12)9-11/h5-6,9,13H,4,7-8,10,19H2,1-3H3 |
| InChIKey | ZRRSQJPDILXYFT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|