C16H18N2O4 — CID 71299362
5-amino-3-(2-methoxyethyl)-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299362) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-amino-3-(2-methoxyethyl)-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-3-(2-methoxyethyl)-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299362 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-amino-3-(2-methoxyethyl)-8-methyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | COCCN1C(=O)CC2C(=C(N)Oc3cc(C)ccc32)C1=O |
| InChI | InChI=1S/C16H18N2O4/c1-9-3-4-10-11-8-13(19)18(5-6-21-2)16(20)14(11)15(17)22-12(10)7-9/h3-4,7,11H,5-6,8,17H2,1-2H3 |
| InChIKey | KTHRTEBVYWYQMF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|