C16H14N2O3 — CID 71299363
5-amino-8-methyl-3-prop-2-ynyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299363) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-amino-8-methyl-3-prop-2-ynyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-8-methyl-3-prop-2-ynyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299363 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-amino-8-methyl-3-prop-2-ynyl-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | C#CCN1C(=O)CC2C(=C(N)Oc3cc(C)ccc32)C1=O |
| InChI | InChI=1S/C16H14N2O3/c1-3-6-18-13(19)8-11-10-5-4-9(2)7-12(10)21-15(17)14(11)16(18)20/h1,4-5,7,11H,6,8,17H2,2H3 |
| InChIKey | WBMNLMYJBZFNDQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|