C20H17ClN2O3 — CID 71299378
5-amino-3-[2-(4-chlorophenyl)ethyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione (PubChem CID 71299378) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 5-amino-3-[2-(4-chlorophenyl)ethyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione.
| Compound Name | 5-amino-3-[2-(4-chlorophenyl)ethyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
|---|---|
| PubChem CID | 71299378 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-amino-3-[2-(4-chlorophenyl)ethyl]-1,10b-dihydrochromeno[3,4-c]pyridine-2,4-dione |
| SMILES | NC1=C2C(=O)N(CCc3ccc(Cl)cc3)C(=O)CC2c2ccccc2O1 |
| InChI | InChI=1S/C20H17ClN2O3/c21-13-7-5-12(6-8-13)9-10-23-17(24)11-15-14-3-1-2-4-16(14)26-19(22)18(15)20(23)25/h1-8,15H,9-11,22H2 |
| InChIKey | SQQBIRGIDLWJIF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|