About CID 71299666
CID 71299666 (PubChem CID 71299666) has the molecular formula C35H25N5NaO7S
and a molecular weight of 682.67 g/mol.
Molecular Properties
| Compound Name | CID 71299666 |
| PubChem CID | 71299666 |
| Molecular Formula | C35H25N5NaO7S |
| Molecular Weight | 682.67 g/mol |
| Exact Mass | 682.14 |
| IUPAC Name | — |
| SMILES | O=C(O)C1=C/C(=N\Nc2ccc(-c3ccc(N/N=C4\C(=O)c5cc(Nc6ccccc6)ccc5C=C4S(=O)(=O)O)cc3)cc2)C=CC1=O.[Na] |
| InChI | InChI=1S/C35H25N5O7S.Na/c41-31-17-16-28(20-30(31)35(43)44)39-37-25-11-6-21(7-12-25)22-8-13-26(14-9-22)38-40-33-32(48(45,46)47)18-23-10-15-27(19-29(23)34(33)42)36-24-4-2-1-3-5-24;/h1-20,36-38H,(H,43,44)(H,45,46,47);/b39-28-,40-33-; |
| InChIKey | ZAKSMFMRJSRDGW-QTMZSCGTSA-N |
| XLogP | 5.53 |
| TPSA | 186.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 682.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 71299666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71299666?
The IUPAC name of CID 71299666 (CID 71299666) is not available.
What is the SMILES notation for CID 71299666?
The canonical SMILES for CID 71299666 is O=C(O)C1=C/C(=N\Nc2ccc(-c3ccc(N/N=C4\C(=O)c5cc(Nc6ccccc6)ccc5C=C4S(=O)(=O)O)cc3)cc2)C=CC1=O.[Na].
What is the InChIKey of CID 71299666?
The InChIKey is ZAKSMFMRJSRDGW-QTMZSCGTSA-N. The full InChI is InChI=1S/C35H25N5O7S.Na/c41-31-17-16-28(20-30(31)35(43)44)39-37-25-11-6-21(7-12-25)22-8-13-26(14-9-22)38-40-33-32(48(45,46)47)18-23-10-15-27(19-29(23)34(33)42)36-24-4-2-1-3-5-24;/h1-20,36-38H,(H,43,44)(H,45,46,47);/b39-28-,40-33-;.
What are the key properties of CID 71299666?
CID 71299666 has a molecular weight of 682.67 g/mol, XLogP of 5.53, 9 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71299666 is sourced from PubChem (CID 71299666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).