C8H15ClN4O2 — CID 71299790
5,6-diamino-1,3-diethylpyrimidine-2,4-dione;hydrochloride (PubChem CID 71299790) has the molecular formula C8H15ClN4O2 and a molecular weight of 234.69 g/mol. Its IUPAC name is 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;hydrochloride.
| Compound Name | 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 71299790 |
| Molecular Formula | C8H15ClN4O2 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;hydrochloride |
| SMILES | CCn1c(N)c(N)c(=O)n(CC)c1=O.Cl |
| InChI | InChI=1S/C8H14N4O2.ClH/c1-3-11-6(10)5(9)7(13)12(4-2)8(11)14;/h3-4,9-10H2,1-2H3;1H |
| InChIKey | UQWLJOFXKBZWCI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |