About N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine
N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 71300260) has the molecular formula C14H14N2OS
and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine |
| PubChem CID | 71300260 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(C)c2sc(NCc3ccco3)nc12 |
| InChI | InChI=1S/C14H14N2OS/c1-9-5-6-10(2)13-12(9)16-14(18-13)15-8-11-4-3-7-17-11/h3-7H,8H2,1-2H3,(H,15,16) |
| InChIKey | XCEJDAURDIOGOB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine?
The IUPAC name of N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine (CID 71300260) is N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine is Cc1ccc(C)c2sc(NCc3ccco3)nc12.
What is the InChIKey of N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine?
The InChIKey is XCEJDAURDIOGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2OS/c1-9-5-6-10(2)13-12(9)16-14(18-13)15-8-11-4-3-7-17-11/h3-7H,8H2,1-2H3,(H,15,16).
What are the key properties of N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine?
N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine has a molecular weight of 258.35 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 71300260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).