C14H14N2OS — CID 71300260
N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 71300260) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 71300260 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-4,7-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(C)c2sc(NCc3ccco3)nc12 |
| InChI | InChI=1S/C14H14N2OS/c1-9-5-6-10(2)13-12(9)16-14(18-13)15-8-11-4-3-7-17-11/h3-7H,8H2,1-2H3,(H,15,16) |
| InChIKey | XCEJDAURDIOGOB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |