C20H26Cl4N10 — CID 71300434
1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide;dihydrochloride (PubChem CID 71300434) has the molecular formula C20H26Cl4N10 and a molecular weight of 548.31 g/mol. Its IUPAC name is 1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide;dihydrochloride.
| Compound Name | 1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 71300434 |
| Molecular Formula | C20H26Cl4N10 |
| Molecular Weight | 548.31 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=N\c1ccc(Cl)cc1)/N=C(\N)N1CCN(/C(N)=N/C(N)=N/c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H24Cl2N10.2ClH/c21-13-1-5-15(6-2-13)27-17(23)29-19(25)31-9-11-32(12-10-31)20(26)30-18(24)28-16-7-3-14(22)4-8-16;;/h1-8H,9-12H2,(H4,23,25,27,29)(H4,24,26,28,30);2*1H |
| InChIKey | VJVSCTKGPDDOBN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|