About [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine
[3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine (PubChem CID 71301006) has the molecular formula C30H55N3O2
and a molecular weight of 489.79 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine.
Molecular Properties
| Compound Name | [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine |
| PubChem CID | 71301006 |
| Molecular Formula | C30H55N3O2 |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 489.43 |
| IUPAC Name | [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine |
| SMILES | C=CC(=O)OC.CCCCCCCC/C=C\CCCCCCCCN.NCc1cccc(CN)c1 |
| InChI | InChI=1S/C18H37N.C8H12N2.C4H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;9-5-7-2-1-3-8(4-7)6-10;1-3-4(5)6-2/h9-10H,2-8,11-19H2,1H3;1-4H,5-6,9-10H2;3H,1H2,2H3/b10-9-;; |
| InChIKey | IQMQNUIXHWYSNZ-XXAVUKJNSA-N |
| XLogP | 6.93 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine?
The IUPAC name of [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine (CID 71301006) is [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine.
What is the SMILES notation for [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine?
The canonical SMILES for [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine is C=CC(=O)OC.CCCCCCCC/C=C\CCCCCCCCN.NCc1cccc(CN)c1.
What is the InChIKey of [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine?
The InChIKey is IQMQNUIXHWYSNZ-XXAVUKJNSA-N. The full InChI is InChI=1S/C18H37N.C8H12N2.C4H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;9-5-7-2-1-3-8(4-7)6-10;1-3-4(5)6-2/h9-10H,2-8,11-19H2,1H3;1-4H,5-6,9-10H2;3H,1H2,2H3/b10-9-;;.
What are the key properties of [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine?
[3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine has a molecular weight of 489.79 g/mol, XLogP of 6.93, 18 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)phenyl]methanamine;methyl prop-2-enoate;(Z)-octadec-9-en-1-amine is sourced from PubChem (CID 71301006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).