About [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride
[(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride (PubChem CID 71301089) has the molecular formula C16H22ClNO2
and a molecular weight of 295.81 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride.
Molecular Properties
| Compound Name | [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride |
| PubChem CID | 71301089 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride |
| SMILES | CC(=O)OC1(c2ccccc2)C[C@H]2CC[C@@H](C1)N2C.Cl |
| InChI | InChI=1S/C16H21NO2.ClH/c1-12(18)19-16(13-6-4-3-5-7-13)10-14-8-9-15(11-16)17(14)2;/h3-7,14-15H,8-11H2,1-2H3;1H/t14-,15+,16?; |
| InChIKey | LNFMRGGIRUVLQE-JXMYBXCISA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride?
The IUPAC name of [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride (CID 71301089) is [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride.
What is the SMILES notation for [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride?
The canonical SMILES for [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride is CC(=O)OC1(c2ccccc2)C[C@H]2CC[C@@H](C1)N2C.Cl.
What is the InChIKey of [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride?
The InChIKey is LNFMRGGIRUVLQE-JXMYBXCISA-N. The full InChI is InChI=1S/C16H21NO2.ClH/c1-12(18)19-16(13-6-4-3-5-7-13)10-14-8-9-15(11-16)17(14)2;/h3-7,14-15H,8-11H2,1-2H3;1H/t14-,15+,16?;.
What are the key properties of [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride?
[(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride has a molecular weight of 295.81 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octan-3-yl] acetate;hydrochloride is sourced from PubChem (CID 71301089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).