About 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide
5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide (PubChem CID 71301445) has the molecular formula C20H21N5O
and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide.
Molecular Properties
| Compound Name | 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide |
| PubChem CID | 71301445 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide |
| SMILES | CN1CCN(C)/C(=N\c2ccc(C#N)cc2C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H21N5O/c1-24-10-11-25(2)19(14-24)23-18-9-8-15(13-21)12-17(18)20(26)22-16-6-4-3-5-7-16/h3-9,12H,10-11,14H2,1-2H3,(H,22,26)/b23-19- |
| InChIKey | HPNYOSMNUIUJBY-NMWGTECJSA-N |
| XLogP | 2.72 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide?
The IUPAC name of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide (CID 71301445) is 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide.
What is the SMILES notation for 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide?
The canonical SMILES for 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide is CN1CCN(C)/C(=N\c2ccc(C#N)cc2C(=O)Nc2ccccc2)C1.
What is the InChIKey of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide?
The InChIKey is HPNYOSMNUIUJBY-NMWGTECJSA-N. The full InChI is InChI=1S/C20H21N5O/c1-24-10-11-25(2)19(14-24)23-18-9-8-15(13-21)12-17(18)20(26)22-16-6-4-3-5-7-16/h3-9,12H,10-11,14H2,1-2H3,(H,22,26)/b23-19-.
What are the key properties of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide?
5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide has a molecular weight of 347.42 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-phenylbenzamide is sourced from PubChem (CID 71301445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).