About 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide
5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide (PubChem CID 71301449) has the molecular formula C20H20FN5O
and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide.
Molecular Properties
| Compound Name | 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide |
| PubChem CID | 71301449 |
| Molecular Formula | C20H20FN5O |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide |
| SMILES | CN1CCN(C)/C(=N\c2ccc(C#N)cc2C(=O)Nc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H20FN5O/c1-25-8-9-26(2)19(13-25)24-18-7-6-14(12-22)10-17(18)20(27)23-16-5-3-4-15(21)11-16/h3-7,10-11H,8-9,13H2,1-2H3,(H,23,27)/b24-19- |
| InChIKey | IQVANPTXQFZVGN-CLCOLTQESA-N |
| XLogP | 2.86 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide?
The IUPAC name of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide (CID 71301449) is 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide.
What is the SMILES notation for 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide?
The canonical SMILES for 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide is CN1CCN(C)/C(=N\c2ccc(C#N)cc2C(=O)Nc2cccc(F)c2)C1.
What is the InChIKey of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide?
The InChIKey is IQVANPTXQFZVGN-CLCOLTQESA-N. The full InChI is InChI=1S/C20H20FN5O/c1-25-8-9-26(2)19(13-25)24-18-7-6-14(12-22)10-17(18)20(27)23-16-5-3-4-15(21)11-16/h3-7,10-11H,8-9,13H2,1-2H3,(H,23,27)/b24-19-.
What are the key properties of 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide?
5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide has a molecular weight of 365.41 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-N-(3-fluorophenyl)benzamide is sourced from PubChem (CID 71301449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).