About 1H-imidazole-2-sulfonyl chloride;hydrochloride
1H-imidazole-2-sulfonyl chloride;hydrochloride (PubChem CID 71302078) has the molecular formula C3H4Cl2N2O2S
and a molecular weight of 203.05 g/mol. Its IUPAC name is 1H-imidazole-2-sulfonyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 1H-imidazole-2-sulfonyl chloride;hydrochloride |
| PubChem CID | 71302078 |
| Molecular Formula | C3H4Cl2N2O2S |
| Molecular Weight | 203.05 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | 1H-imidazole-2-sulfonyl chloride;hydrochloride |
| SMILES | Cl.O=S(=O)(Cl)c1ncc[nH]1 |
| InChI | InChI=1S/C3H3ClN2O2S.ClH/c4-9(7,8)3-5-1-2-6-3;/h1-2H,(H,5,6);1H |
| InChIKey | PLUHSJKCLGXHLG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.05 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazole-2-sulfonyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole-2-sulfonyl chloride;hydrochloride?
The IUPAC name of 1H-imidazole-2-sulfonyl chloride;hydrochloride (CID 71302078) is 1H-imidazole-2-sulfonyl chloride;hydrochloride.
What is the SMILES notation for 1H-imidazole-2-sulfonyl chloride;hydrochloride?
The canonical SMILES for 1H-imidazole-2-sulfonyl chloride;hydrochloride is Cl.O=S(=O)(Cl)c1ncc[nH]1.
What is the InChIKey of 1H-imidazole-2-sulfonyl chloride;hydrochloride?
The InChIKey is PLUHSJKCLGXHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3ClN2O2S.ClH/c4-9(7,8)3-5-1-2-6-3;/h1-2H,(H,5,6);1H.
What are the key properties of 1H-imidazole-2-sulfonyl chloride;hydrochloride?
1H-imidazole-2-sulfonyl chloride;hydrochloride has a molecular weight of 203.05 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole-2-sulfonyl chloride;hydrochloride is sourced from PubChem (CID 71302078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).