C8H3Cl2NO3 — CID 71302882
6,8-dichloro-8H-3,1-benzoxazine-2,4-dione (PubChem CID 71302882) has the molecular formula C8H3Cl2NO3 and a molecular weight of 232.02 g/mol. Its IUPAC name is 6,8-dichloro-8H-3,1-benzoxazine-2,4-dione.
| Compound Name | 6,8-dichloro-8H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 71302882 |
| Molecular Formula | C8H3Cl2NO3 |
| Molecular Weight | 232.02 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 6,8-dichloro-8H-3,1-benzoxazine-2,4-dione |
| SMILES | O=C1N=C2C(=CC(Cl)=CC2Cl)C(=O)O1 |
| InChI | InChI=1S/C8H3Cl2NO3/c9-3-1-4-6(5(10)2-3)11-8(13)14-7(4)12/h1-2,5H |
| InChIKey | TVZFNVCYPSSFIA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.02 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|