About 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride
4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride (PubChem CID 71303349) has the molecular formula C7H8Cl2N2
and a molecular weight of 191.06 g/mol. Its IUPAC name is 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride |
| PubChem CID | 71303349 |
| Molecular Formula | C7H8Cl2N2 |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride |
| SMILES | Cl.Clc1ccnc2c1CNC2 |
| InChI | InChI=1S/C7H7ClN2.ClH/c8-6-1-2-10-7-4-9-3-5(6)7;/h1-2,9H,3-4H2;1H |
| InChIKey | WFMMYLYVLCXQNS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride?
The IUPAC name of 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride (CID 71303349) is 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride.
What is the SMILES notation for 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride?
The canonical SMILES for 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride is Cl.Clc1ccnc2c1CNC2.
What is the InChIKey of 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride?
The InChIKey is WFMMYLYVLCXQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2.ClH/c8-6-1-2-10-7-4-9-3-5(6)7;/h1-2,9H,3-4H2;1H.
What are the key properties of 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride?
4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride has a molecular weight of 191.06 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;hydrochloride is sourced from PubChem (CID 71303349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).