C8H8N2O — CID 71303629
5,6-dimethyl-2-oxo-3H-pyridine-3-carbonitrile (PubChem CID 71303629) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 5,6-dimethyl-2-oxo-3H-pyridine-3-carbonitrile.
| Compound Name | 5,6-dimethyl-2-oxo-3H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71303629 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5,6-dimethyl-2-oxo-3H-pyridine-3-carbonitrile |
| SMILES | CC1=CC(C#N)C(=O)N=C1C |
| InChI | InChI=1S/C8H8N2O/c1-5-3-7(4-9)8(11)10-6(5)2/h3,7H,1-2H3 |
| InChIKey | FQWQVGGRGOYGIY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |