About 5-ethyldiazinan-3-one
5-ethyldiazinan-3-one (PubChem CID 71303752) has the molecular formula C6H12N2O
and a molecular weight of 128.18 g/mol. Its IUPAC name is 5-ethyldiazinan-3-one.
Molecular Properties
| Compound Name | 5-ethyldiazinan-3-one |
| PubChem CID | 71303752 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 5-ethyldiazinan-3-one |
| SMILES | CCC1CNNC(=O)C1 |
| InChI | InChI=1S/C6H12N2O/c1-2-5-3-6(9)8-7-4-5/h5,7H,2-4H2,1H3,(H,8,9) |
| InChIKey | IHNHEOFJKSTVGA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyldiazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyldiazinan-3-one?
The IUPAC name of 5-ethyldiazinan-3-one (CID 71303752) is 5-ethyldiazinan-3-one.
What is the SMILES notation for 5-ethyldiazinan-3-one?
The canonical SMILES for 5-ethyldiazinan-3-one is CCC1CNNC(=O)C1.
What is the InChIKey of 5-ethyldiazinan-3-one?
The InChIKey is IHNHEOFJKSTVGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-2-5-3-6(9)8-7-4-5/h5,7H,2-4H2,1H3,(H,8,9).
What are the key properties of 5-ethyldiazinan-3-one?
5-ethyldiazinan-3-one has a molecular weight of 128.18 g/mol, XLogP of 0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyldiazinan-3-one is sourced from PubChem (CID 71303752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).