About 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one
6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 71303963) has the molecular formula C7H4FN3O
and a molecular weight of 165.13 g/mol. Its IUPAC name is 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one |
| PubChem CID | 71303963 |
| Molecular Formula | C7H4FN3O |
| Molecular Weight | 165.13 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=C1N=CN=C2C=NC(F)C=C12 |
| InChI | InChI=1S/C7H4FN3O/c8-6-1-4-5(2-9-6)10-3-11-7(4)12/h1-3,6H |
| InChIKey | PHCWQFYQOUGWMW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.13 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one?
The IUPAC name of 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one (CID 71303963) is 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one?
The canonical SMILES for 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one is O=C1N=CN=C2C=NC(F)C=C12.
What is the InChIKey of 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one?
The InChIKey is PHCWQFYQOUGWMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN3O/c8-6-1-4-5(2-9-6)10-3-11-7(4)12/h1-3,6H.
What are the key properties of 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one?
6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one has a molecular weight of 165.13 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-6H-pyrido[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 71303963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).