About 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane]
7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] (PubChem CID 71304013) has the molecular formula C12H14BrN
and a molecular weight of 252.15 g/mol. Its IUPAC name is 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane].
Molecular Properties
| Compound Name | 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] |
| PubChem CID | 71304013 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] |
| SMILES | Brc1ccc2c(c1)CNCC21CCC1 |
| InChI | InChI=1S/C12H14BrN/c13-10-2-3-11-9(6-10)7-14-8-12(11)4-1-5-12/h2-3,6,14H,1,4-5,7-8H2 |
| InChIKey | PROQQGYSPZSSHF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane]?
The IUPAC name of 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] (CID 71304013) is 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane].
What is the SMILES notation for 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane]?
The canonical SMILES for 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] is Brc1ccc2c(c1)CNCC21CCC1.
What is the InChIKey of 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane]?
The InChIKey is PROQQGYSPZSSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN/c13-10-2-3-11-9(6-10)7-14-8-12(11)4-1-5-12/h2-3,6,14H,1,4-5,7-8H2.
What are the key properties of 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane]?
7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] has a molecular weight of 252.15 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclobutane] is sourced from PubChem (CID 71304013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).