About ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate
ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate (PubChem CID 71304230) has the molecular formula C19H32N2O5
and a molecular weight of 368.47 g/mol. Its IUPAC name is ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
| PubChem CID | 71304230 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
| SMILES | CC1C(=O)N(C(=O)OC(C)(C)C)CC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C19H32N2O5/c1-13-14(22)21(16(24)26-18(5,6)7)12-19(13)8-10-20(11-9-19)15(23)25-17(2,3)4/h13H,8-12H2,1-7H3 |
| InChIKey | KDNPTBCVXOYYMW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate?
The IUPAC name of ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate (CID 71304230) is ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate.
What is the SMILES notation for ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate?
The canonical SMILES for ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate is CC1C(=O)N(C(=O)OC(C)(C)C)CC12CCN(C(=O)OC(C)(C)C)CC2.
What is the InChIKey of ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate?
The InChIKey is KDNPTBCVXOYYMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O5/c1-13-14(22)21(16(24)26-18(5,6)7)12-19(13)8-10-20(11-9-19)15(23)25-17(2,3)4/h13H,8-12H2,1-7H3.
What are the key properties of ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate?
ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate has a molecular weight of 368.47 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 4-methyl-3-oxo-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate is sourced from PubChem (CID 71304230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).