methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate

C13H9F2NO2 — CID 71304424

IUPACmethyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate
SMILESCOC(=O)c1cncc(-c2ccc(F)cc2F)c1
InChIInChI=1S/C13H9F2NO2/c1-18-13(17)9-4-8(6-16-7-9)11-3-2-10(14)5-12(11)15/h2-7H,1H3
InChIKeyBZTJGSHWKXFZMA-UHFFFAOYSA-N
MW249.22 g/mol
LogP2.81
Rot. Bonds2

About methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate

methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate (PubChem CID 71304424) has the molecular formula C13H9F2NO2 and a molecular weight of 249.22 g/mol. Its IUPAC name is methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate
PubChem CID71304424
Molecular FormulaC13H9F2NO2
Molecular Weight249.22 g/mol
Exact Mass249.06
IUPAC Namemethyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate
SMILESCOC(=O)c1cncc(-c2ccc(F)cc2F)c1
InChIInChI=1S/C13H9F2NO2/c1-18-13(17)9-4-8(6-16-7-9)11-3-2-10(14)5-12(11)15/h2-7H,1H3
InChIKeyBZTJGSHWKXFZMA-UHFFFAOYSA-N
XLogP2.81
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.22
LogP ≤ 52.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate?
The IUPAC name of methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate (CID 71304424) is methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate?
The canonical SMILES for methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate is COC(=O)c1cncc(-c2ccc(F)cc2F)c1.
What is the InChIKey of methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate?
The InChIKey is BZTJGSHWKXFZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F2NO2/c1-18-13(17)9-4-8(6-16-7-9)11-3-2-10(14)5-12(11)15/h2-7H,1H3.
What are the key properties of methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate?
methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate has a molecular weight of 249.22 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,4-difluorophenyl)pyridine-3-carboxylate is sourced from PubChem (CID 71304424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).