About spiro[2.5]octan-6-amine;hydrochloride
spiro[2.5]octan-6-amine;hydrochloride (PubChem CID 71304606) has the molecular formula C8H16ClN
and a molecular weight of 161.68 g/mol. Its IUPAC name is spiro[2.5]octan-6-amine;hydrochloride.
Molecular Properties
| Compound Name | spiro[2.5]octan-6-amine;hydrochloride |
| PubChem CID | 71304606 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | spiro[2.5]octan-6-amine;hydrochloride |
| SMILES | Cl.NC1CCC2(CC1)CC2 |
| InChI | InChI=1S/C8H15N.ClH/c9-7-1-3-8(4-2-7)5-6-8;/h7H,1-6,9H2;1H |
| InChIKey | CXEHVYGSYCWAQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[2.5]octan-6-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.5]octan-6-amine;hydrochloride?
The IUPAC name of spiro[2.5]octan-6-amine;hydrochloride (CID 71304606) is spiro[2.5]octan-6-amine;hydrochloride.
What is the SMILES notation for spiro[2.5]octan-6-amine;hydrochloride?
The canonical SMILES for spiro[2.5]octan-6-amine;hydrochloride is Cl.NC1CCC2(CC1)CC2.
What is the InChIKey of spiro[2.5]octan-6-amine;hydrochloride?
The InChIKey is CXEHVYGSYCWAQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.ClH/c9-7-1-3-8(4-2-7)5-6-8;/h7H,1-6,9H2;1H.
What are the key properties of spiro[2.5]octan-6-amine;hydrochloride?
spiro[2.5]octan-6-amine;hydrochloride has a molecular weight of 161.68 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.5]octan-6-amine;hydrochloride is sourced from PubChem (CID 71304606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).