About 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide
4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide (PubChem CID 71306082) has the molecular formula C9H16FNO2S
and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide |
| PubChem CID | 71306082 |
| Molecular Formula | C9H16FNO2S |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(CF)C12CCNCC2 |
| InChI | InChI=1S/C9H16FNO2S/c10-7-8-1-6-14(12,13)9(8)2-4-11-5-3-9/h8,11H,1-7H2 |
| InChIKey | SQSRTOCEPJZDSV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide?
The IUPAC name of 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide (CID 71306082) is 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide.
What is the SMILES notation for 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide?
The canonical SMILES for 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide is O=S1(=O)CCC(CF)C12CCNCC2.
What is the InChIKey of 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide?
The InChIKey is SQSRTOCEPJZDSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FNO2S/c10-7-8-1-6-14(12,13)9(8)2-4-11-5-3-9/h8,11H,1-7H2.
What are the key properties of 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide?
4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide has a molecular weight of 221.30 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoromethyl)-1λ6-thia-8-azaspiro[4.5]decane 1,1-dioxide is sourced from PubChem (CID 71306082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).