About 3-amino-6-methyl-1,3-dihydroindol-2-one
3-amino-6-methyl-1,3-dihydroindol-2-one (PubChem CID 71306235) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-amino-6-methyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-amino-6-methyl-1,3-dihydroindol-2-one |
| PubChem CID | 71306235 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-amino-6-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc2c(c1)NC(=O)C2N |
| InChI | InChI=1S/C9H10N2O/c1-5-2-3-6-7(4-5)11-9(12)8(6)10/h2-4,8H,10H2,1H3,(H,11,12) |
| InChIKey | NDNSBBUGJCECSF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-6-methyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methyl-1,3-dihydroindol-2-one?
The IUPAC name of 3-amino-6-methyl-1,3-dihydroindol-2-one (CID 71306235) is 3-amino-6-methyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-amino-6-methyl-1,3-dihydroindol-2-one?
The canonical SMILES for 3-amino-6-methyl-1,3-dihydroindol-2-one is Cc1ccc2c(c1)NC(=O)C2N.
What is the InChIKey of 3-amino-6-methyl-1,3-dihydroindol-2-one?
The InChIKey is NDNSBBUGJCECSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-5-2-3-6-7(4-5)11-9(12)8(6)10/h2-4,8H,10H2,1H3,(H,11,12).
What are the key properties of 3-amino-6-methyl-1,3-dihydroindol-2-one?
3-amino-6-methyl-1,3-dihydroindol-2-one has a molecular weight of 162.19 g/mol, XLogP of 0.95, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 71306235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).