About (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride
(3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride (PubChem CID 71306254) has the molecular formula C5H9ClN2O
and a molecular weight of 148.59 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride |
| PubChem CID | 71306254 |
| Molecular Formula | C5H9ClN2O |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride |
| SMILES | Cc1nocc1CN.Cl |
| InChI | InChI=1S/C5H8N2O.ClH/c1-4-5(2-6)3-8-7-4;/h3H,2,6H2,1H3;1H |
| InChIKey | XARZHXFCWAQESD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride?
The IUPAC name of (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride (CID 71306254) is (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride.
What is the SMILES notation for (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride?
The canonical SMILES for (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride is Cc1nocc1CN.Cl.
What is the InChIKey of (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride?
The InChIKey is XARZHXFCWAQESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.ClH/c1-4-5(2-6)3-8-7-4;/h3H,2,6H2,1H3;1H.
What are the key properties of (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride?
(3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride has a molecular weight of 148.59 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-oxazol-4-yl)methanamine;hydrochloride is sourced from PubChem (CID 71306254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).