C12H14O2 — CID 71306353
(2E,4E,6E,8E)-2,6-dimethyldeca-2,4,6,8-tetraenedial (PubChem CID 71306353) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2E,4E,6E,8E)-2,6-dimethyldeca-2,4,6,8-tetraenedial.
| Compound Name | (2E,4E,6E,8E)-2,6-dimethyldeca-2,4,6,8-tetraenedial |
|---|---|
| PubChem CID | 71306353 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2E,4E,6E,8E)-2,6-dimethyldeca-2,4,6,8-tetraenedial |
| SMILES | C/C(C=O)=C\C=C\C(C)=C\C=C\C=O |
| InChI | InChI=1S/C12H14O2/c1-11(6-3-4-9-13)7-5-8-12(2)10-14/h3-10H,1-2H3/b4-3+,7-5+,11-6+,12-8+ |
| InChIKey | NOURWHKLHSWPGX-KIUBFKPTSA-N |
| XLogP | 2.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|