C18H29BClNO2 — CID 71306593
1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-ium chloride (PubChem CID 71306593) has the molecular formula C18H29BClNO2 and a molecular weight of 337.70 g/mol. Its IUPAC name is 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-ium chloride.
| Compound Name | 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-ium chloride |
|---|---|
| PubChem CID | 71306593 |
| Molecular Formula | C18H29BClNO2 |
| Molecular Weight | 337.70 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-1-ium chloride |
| SMILES | CC1(C)OB(c2cccc(C[NH+]3CCCCC3)c2)OC1(C)C.[Cl-] |
| InChI | InChI=1S/C18H28BNO2.ClH/c1-17(2)18(3,4)22-19(21-17)16-10-8-9-15(13-16)14-20-11-6-5-7-12-20;/h8-10,13H,5-7,11-12,14H2,1-4H3;1H |
| InChIKey | DCRYLAICZGZFJF-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.70 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|